C36H62N4O4 — CID 18715875
3-methyl-4-[2-[4-(2-methylbutyl)-2,5-dioxo-1-(2,2,6,6-tetramethylpiperidin-4-yl)pyrrolidin-3-yl]butyl]-1-(2,2,6,6-tetramethylpiperidin-4-yl)pyrrolidine-2,5-dione (PubChem CID 18715875) has the molecular formula C36H62N4O4 and a molecular weight of 614.92 g/mol. Its IUPAC name is 3-methyl-4-[2-[4-(2-methylbutyl)-2,5-dioxo-1-(2,2,6,6-tetramethylpiperidin-4-yl)pyrrolidin-3-yl]butyl]-1-(2,2,6,6-tetramethylpiperidin-4-yl)pyrrolidine-2,5-dione.
| Compound Name | 3-methyl-4-[2-[4-(2-methylbutyl)-2,5-dioxo-1-(2,2,6,6-tetramethylpiperidin-4-yl)pyrrolidin-3-yl]butyl]-1-(2,2,6,6-tetramethylpiperidin-4-yl)pyrrolidine-2,5-dione |
|---|---|
| PubChem CID | 18715875 |
| Molecular Formula | C36H62N4O4 |
| Molecular Weight | 614.92 g/mol |
| Exact Mass | 614.48 |
| IUPAC Name | 3-methyl-4-[2-[4-(2-methylbutyl)-2,5-dioxo-1-(2,2,6,6-tetramethylpiperidin-4-yl)pyrrolidin-3-yl]butyl]-1-(2,2,6,6-tetramethylpiperidin-4-yl)pyrrolidine-2,5-dione |
| SMILES | CCC(C)CC1C(=O)N(C2CC(C)(C)NC(C)(C)C2)C(=O)C1C(CC)CC1C(=O)N(C2CC(C)(C)NC(C)(C)C2)C(=O)C1C |
| InChI | InChI=1S/C36H62N4O4/c1-13-21(3)15-27-28(32(44)40(31(27)43)25-19-35(9,10)38-36(11,12)20-25)23(14-2)16-26-22(4)29(41)39(30(26)42)24-17-33(5,6)37-34(7,8)18-24/h21-28,37-38H,13-20H2,1-12H3 |
| InChIKey | VCXRZKWFWNDNKV-UHFFFAOYSA-N |
| XLogP | 5.68 |
| TPSA | 98.82 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 614.92 |
| LogP ≤ 5 | 5.68 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|