About [4-(hydroxymethyl)-1,4-dimethylpiperazine-1,4-diium-1-yl]methanol
[4-(hydroxymethyl)-1,4-dimethylpiperazine-1,4-diium-1-yl]methanol (PubChem CID 18715982) has the molecular formula C8H20N2O2+2
and a molecular weight of 176.26 g/mol. Its IUPAC name is [4-(hydroxymethyl)-1,4-dimethylpiperazine-1,4-diium-1-yl]methanol.
Molecular Properties
| Compound Name | [4-(hydroxymethyl)-1,4-dimethylpiperazine-1,4-diium-1-yl]methanol |
| PubChem CID | 18715982 |
| Molecular Formula | C8H20N2O2+2 |
| Molecular Weight | 176.26 g/mol |
| Exact Mass | 176.15 |
| IUPAC Name | [4-(hydroxymethyl)-1,4-dimethylpiperazine-1,4-diium-1-yl]methanol |
| SMILES | C[N+]1(CO)CC[N+](C)(CO)CC1 |
| InChI | InChI=1S/C8H20N2O2/c1-9(7-11)3-5-10(2,8-12)6-4-9/h11-12H,3-8H2,1-2H3/q+2 |
| InChIKey | DAACAYPCJVIPLL-UHFFFAOYSA-N |
| XLogP | -1.21 |
| TPSA | 40.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 176.26 |
| LogP ≤ 5 | -1.21 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|
Analyze [4-(hydroxymethyl)-1,4-dimethylpiperazine-1,4-diium-1-yl]methanol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [4-(hydroxymethyl)-1,4-dimethylpiperazine-1,4-diium-1-yl]methanol?
The IUPAC name of [4-(hydroxymethyl)-1,4-dimethylpiperazine-1,4-diium-1-yl]methanol (CID 18715982) is [4-(hydroxymethyl)-1,4-dimethylpiperazine-1,4-diium-1-yl]methanol.
What is the SMILES notation for [4-(hydroxymethyl)-1,4-dimethylpiperazine-1,4-diium-1-yl]methanol?
The canonical SMILES for [4-(hydroxymethyl)-1,4-dimethylpiperazine-1,4-diium-1-yl]methanol is C[N+]1(CO)CC[N+](C)(CO)CC1.
What is the InChIKey of [4-(hydroxymethyl)-1,4-dimethylpiperazine-1,4-diium-1-yl]methanol?
The InChIKey is DAACAYPCJVIPLL-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H20N2O2/c1-9(7-11)3-5-10(2,8-12)6-4-9/h11-12H,3-8H2,1-2H3/q+2.
What are the key properties of [4-(hydroxymethyl)-1,4-dimethylpiperazine-1,4-diium-1-yl]methanol?
[4-(hydroxymethyl)-1,4-dimethylpiperazine-1,4-diium-1-yl]methanol has a molecular weight of 176.26 g/mol, XLogP of -1.21, 2 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for [4-(hydroxymethyl)-1,4-dimethylpiperazine-1,4-diium-1-yl]methanol is sourced from PubChem (CID 18715982), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).