C7H14N2 — CID 18716064
2,3,4,5-tetramethyl-1,5-dihydropyrazole (PubChem CID 18716064) has the molecular formula C7H14N2 and a molecular weight of 126.20 g/mol. Its IUPAC name is 2,3,4,5-tetramethyl-1,5-dihydropyrazole.
| Compound Name | 2,3,4,5-tetramethyl-1,5-dihydropyrazole |
|---|---|
| PubChem CID | 18716064 |
| Molecular Formula | C7H14N2 |
| Molecular Weight | 126.20 g/mol |
| Exact Mass | 126.12 |
| IUPAC Name | 2,3,4,5-tetramethyl-1,5-dihydropyrazole |
| SMILES | CC1=C(C)N(C)NC1C |
| InChI | InChI=1S/C7H14N2/c1-5-6(2)8-9(4)7(5)3/h6,8H,1-4H3 |
| InChIKey | ZLSMRTISVFLURU-UHFFFAOYSA-N |
| XLogP | 1.12 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 9 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 126.20 |
| LogP ≤ 5 | 1.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |