C15H30O5Si — CID 18716195
2-[(4R,6S)-6-[[tert-butyl(dimethyl)silyl]oxymethyl]-2,2-dimethyl-1,3-dioxan-4-yl]acetic acid (PubChem CID 18716195) has the molecular formula C15H30O5Si and a molecular weight of 318.49 g/mol. Its IUPAC name is 2-[(4R,6S)-6-[[tert-butyl(dimethyl)silyl]oxymethyl]-2,2-dimethyl-1,3-dioxan-4-yl]acetic acid.
| Compound Name | 2-[(4R,6S)-6-[[tert-butyl(dimethyl)silyl]oxymethyl]-2,2-dimethyl-1,3-dioxan-4-yl]acetic acid |
|---|---|
| PubChem CID | 18716195 |
| Molecular Formula | C15H30O5Si |
| Molecular Weight | 318.49 g/mol |
| Exact Mass | 318.19 |
| IUPAC Name | 2-[(4R,6S)-6-[[tert-butyl(dimethyl)silyl]oxymethyl]-2,2-dimethyl-1,3-dioxan-4-yl]acetic acid |
| SMILES | CC1(C)O[C@H](CO[Si](C)(C)C(C)(C)C)C[C@H](CC(=O)O)O1 |
| InChI | InChI=1S/C15H30O5Si/c1-14(2,3)21(6,7)18-10-12-8-11(9-13(16)17)19-15(4,5)20-12/h11-12H,8-10H2,1-7H3,(H,16,17)/t11-,12+/m1/s1 |
| InChIKey | GHMVIKMLVUKOHT-NEPJUHHUSA-N |
| XLogP | 3.39 |
| TPSA | 64.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 318.49 |
| LogP ≤ 5 | 3.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|