C41H60O12 — CID 18716232
20-(2,4-dihydroxybutyl)-21-methoxy-14-methyl-8,15-dimethylidene-2,19,30,34,37,39,40,41-octaoxanonacyclo[24.9.2.13,32.13,33.16,9.112,16.018,22.029,36.031,35]hentetracontan-24-one (PubChem CID 18716232) has the molecular formula C41H60O12 and a molecular weight of 744.92 g/mol. Its IUPAC name is 20-(2,4-dihydroxybutyl)-21-methoxy-14-methyl-8,15-dimethylidene-2,19,30,34,37,39,40,41-octaoxanonacyclo[24.9.2.13,32.13,33.16,9.112,16.018,22.029,36.031,35]hentetracontan-24-one.
| Compound Name | 20-(2,4-dihydroxybutyl)-21-methoxy-14-methyl-8,15-dimethylidene-2,19,30,34,37,39,40,41-octaoxanonacyclo[24.9.2.13,32.13,33.16,9.112,16.018,22.029,36.031,35]hentetracontan-24-one |
|---|---|
| PubChem CID | 18716232 |
| Molecular Formula | C41H60O12 |
| Molecular Weight | 744.92 g/mol |
| Exact Mass | 744.41 |
| IUPAC Name | 20-(2,4-dihydroxybutyl)-21-methoxy-14-methyl-8,15-dimethylidene-2,19,30,34,37,39,40,41-octaoxanonacyclo[24.9.2.13,32.13,33.16,9.112,16.018,22.029,36.031,35]hentetracontan-24-one |
| SMILES | C=C1CC2CCC34CC5OC6C(OC7CCC(CC(=O)CC8C(CC9OC(CCC1O2)CC(C)C9=C)OC(CC(O)CCO)C8OC)OC7C6O3)C5O4 |
| InChI | InChI=1S/C41H60O12/c1-20-13-25-5-7-29-21(2)14-27(46-29)9-11-41-19-34-37(52-41)38-39(51-34)40(53-41)36-30(50-38)8-6-26(48-36)15-24(44)16-28-32(18-31(47-25)22(20)3)49-33(35(28)45-4)17-23(43)10-12-42/h20,23,25-40,42-43H,2-3,5-19H2,1,4H3 |
| InChIKey | RIOXTDQAPJAEET-UHFFFAOYSA-N |
| XLogP | 3.86 |
| TPSA | 140.60 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 53 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 744.92 |
| LogP ≤ 5 | 3.86 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|