About CID 18716271
CID 18716271 (PubChem CID 18716271) has the molecular formula C9H12B
and a molecular weight of 131.01 g/mol.
Molecular Properties
| Compound Name | CID 18716271 |
| PubChem CID | 18716271 |
| Molecular Formula | C9H12B |
| Molecular Weight | 131.01 g/mol |
| Exact Mass | 131.10 |
| IUPAC Name | — |
| SMILES | [B]=C1C(C)=C(C)C(C)=C1C |
| InChI | InChI=1S/C9H12B/c1-5-6(2)8(4)9(10)7(5)3/h1-4H3 |
| InChIKey | WTZHHVPQQFDISI-UHFFFAOYSA-N |
| XLogP | 2.01 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 131.01 |
| LogP ≤ 5 | 2.01 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze CID 18716271 with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of CID 18716271?
The IUPAC name of CID 18716271 (CID 18716271) is not available.
What is the SMILES notation for CID 18716271?
The canonical SMILES for CID 18716271 is [B]=C1C(C)=C(C)C(C)=C1C.
What is the InChIKey of CID 18716271?
The InChIKey is WTZHHVPQQFDISI-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H12B/c1-5-6(2)8(4)9(10)7(5)3/h1-4H3.
What are the key properties of CID 18716271?
CID 18716271 has a molecular weight of 131.01 g/mol, XLogP of 2.01, 0 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for CID 18716271 is sourced from PubChem (CID 18716271), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).