C15H28N2O2 — CID 18716435
2,2,3,7,7,8,9,9-octamethyl-1-oxa-3,8-diazaspiro[4.5]decan-4-one (PubChem CID 18716435) has the molecular formula C15H28N2O2 and a molecular weight of 268.40 g/mol. Its IUPAC name is 2,2,3,7,7,8,9,9-octamethyl-1-oxa-3,8-diazaspiro[4.5]decan-4-one.
| Compound Name | 2,2,3,7,7,8,9,9-octamethyl-1-oxa-3,8-diazaspiro[4.5]decan-4-one |
|---|---|
| PubChem CID | 18716435 |
| Molecular Formula | C15H28N2O2 |
| Molecular Weight | 268.40 g/mol |
| Exact Mass | 268.22 |
| IUPAC Name | 2,2,3,7,7,8,9,9-octamethyl-1-oxa-3,8-diazaspiro[4.5]decan-4-one |
| SMILES | CN1C(C)(C)CC2(CC1(C)C)OC(C)(C)N(C)C2=O |
| InChI | InChI=1S/C15H28N2O2/c1-12(2)9-15(10-13(3,4)17(12)8)11(18)16(7)14(5,6)19-15/h9-10H2,1-8H3 |
| InChIKey | HIHVSPKCVJGHLO-UHFFFAOYSA-N |
| XLogP | 2.23 |
| TPSA | 32.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 268.40 |
| LogP ≤ 5 | 2.23 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |