C30H56N2O6 — CID 18716454
bis(1-methoxy-2,2,6,6-tetramethylpiperidin-4-yl) decanedioate (PubChem CID 18716454) has the molecular formula C30H56N2O6 and a molecular weight of 540.79 g/mol. Its IUPAC name is bis(1-methoxy-2,2,6,6-tetramethylpiperidin-4-yl) decanedioate.
| Compound Name | bis(1-methoxy-2,2,6,6-tetramethylpiperidin-4-yl) decanedioate |
|---|---|
| PubChem CID | 18716454 |
| Molecular Formula | C30H56N2O6 |
| Molecular Weight | 540.79 g/mol |
| Exact Mass | 540.41 |
| IUPAC Name | bis(1-methoxy-2,2,6,6-tetramethylpiperidin-4-yl) decanedioate |
| SMILES | CON1C(C)(C)CC(OC(=O)CCCCCCCCC(=O)OC2CC(C)(C)N(OC)C(C)(C)C2)CC1(C)C |
| InChI | InChI=1S/C30H56N2O6/c1-27(2)19-23(20-28(3,4)31(27)35-9)37-25(33)17-15-13-11-12-14-16-18-26(34)38-24-21-29(5,6)32(36-10)30(7,8)22-24/h23-24H,11-22H2,1-10H3 |
| InChIKey | XGJSMYFOSRLZNF-UHFFFAOYSA-N |
| XLogP | 6.36 |
| TPSA | 77.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 540.79 |
| LogP ≤ 5 | 6.36 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|