C42H78N8O2 — CID 18716467
2-N,4-N-dibutyl-2-N,4-N-bis(1-cyclohexyloxy-2,2,6,6-tetramethylpiperidin-4-yl)-6-N-methyl-1,3,5-triazine-2,4,6-triamine (PubChem CID 18716467) has the molecular formula C42H78N8O2 and a molecular weight of 727.14 g/mol. Its IUPAC name is 2-N,4-N-dibutyl-2-N,4-N-bis(1-cyclohexyloxy-2,2,6,6-tetramethylpiperidin-4-yl)-6-N-methyl-1,3,5-triazine-2,4,6-triamine.
| Compound Name | 2-N,4-N-dibutyl-2-N,4-N-bis(1-cyclohexyloxy-2,2,6,6-tetramethylpiperidin-4-yl)-6-N-methyl-1,3,5-triazine-2,4,6-triamine |
|---|---|
| PubChem CID | 18716467 |
| Molecular Formula | C42H78N8O2 |
| Molecular Weight | 727.14 g/mol |
| Exact Mass | 726.62 |
| IUPAC Name | 2-N,4-N-dibutyl-2-N,4-N-bis(1-cyclohexyloxy-2,2,6,6-tetramethylpiperidin-4-yl)-6-N-methyl-1,3,5-triazine-2,4,6-triamine |
| SMILES | CCCCN(c1nc(NC)nc(N(CCCC)C2CC(C)(C)N(OC3CCCCC3)C(C)(C)C2)n1)C1CC(C)(C)N(OC2CCCCC2)C(C)(C)C1 |
| InChI | InChI=1S/C42H78N8O2/c1-12-14-26-47(32-28-39(3,4)49(40(5,6)29-32)51-34-22-18-16-19-23-34)37-44-36(43-11)45-38(46-37)48(27-15-13-2)33-30-41(7,8)50(42(9,10)31-33)52-35-24-20-17-21-25-35/h32-35H,12-31H2,1-11H3,(H,43,44,45,46) |
| InChIKey | MVBBTJTUYHUTRS-UHFFFAOYSA-N |
| XLogP | 9.70 |
| TPSA | 82.12 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 52 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 727.14 |
| LogP ≤ 5 | 9.70 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 10 |