C42H78N8O2 — CID 18716469
2-N-butyl-2-N,6-N-bis(1-cyclohexyloxy-2,2,6,6-tetramethylpiperidin-4-yl)-4-N,4-N-diethyl-6-N-methyl-1,3,5-triazine-2,4,6-triamine (PubChem CID 18716469) has the molecular formula C42H78N8O2 and a molecular weight of 727.14 g/mol. Its IUPAC name is 2-N-butyl-2-N,6-N-bis(1-cyclohexyloxy-2,2,6,6-tetramethylpiperidin-4-yl)-4-N,4-N-diethyl-6-N-methyl-1,3,5-triazine-2,4,6-triamine.
| Compound Name | 2-N-butyl-2-N,6-N-bis(1-cyclohexyloxy-2,2,6,6-tetramethylpiperidin-4-yl)-4-N,4-N-diethyl-6-N-methyl-1,3,5-triazine-2,4,6-triamine |
|---|---|
| PubChem CID | 18716469 |
| Molecular Formula | C42H78N8O2 |
| Molecular Weight | 727.14 g/mol |
| Exact Mass | 726.62 |
| IUPAC Name | 2-N-butyl-2-N,6-N-bis(1-cyclohexyloxy-2,2,6,6-tetramethylpiperidin-4-yl)-4-N,4-N-diethyl-6-N-methyl-1,3,5-triazine-2,4,6-triamine |
| SMILES | CCCCN(c1nc(N(CC)CC)nc(N(C)C2CC(C)(C)N(OC3CCCCC3)C(C)(C)C2)n1)C1CC(C)(C)N(OC2CCCCC2)C(C)(C)C1 |
| InChI | InChI=1S/C42H78N8O2/c1-13-16-27-48(33-30-41(8,9)50(42(10,11)31-33)52-35-25-21-18-22-26-35)38-44-36(43-37(45-38)47(14-2)15-3)46(12)32-28-39(4,5)49(40(6,7)29-32)51-34-23-19-17-20-24-34/h32-35H,13-31H2,1-12H3 |
| InChIKey | LIAYLRWZPOVVPS-UHFFFAOYSA-N |
| XLogP | 9.33 |
| TPSA | 73.33 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 52 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 727.14 |
| LogP ≤ 5 | 9.33 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 10 |