C40H72N8O3 — CID 18716473
N,N'-bis(1-cyclohexyloxy-2,2,6,6-tetramethylpiperidin-4-yl)-N-methyl-N'-(4-methyl-6-morpholin-4-yl-1,3,5-triazin-2-yl)methanediamine (PubChem CID 18716473) has the molecular formula C40H72N8O3 and a molecular weight of 713.07 g/mol. Its IUPAC name is N,N'-bis(1-cyclohexyloxy-2,2,6,6-tetramethylpiperidin-4-yl)-N-methyl-N'-(4-methyl-6-morpholin-4-yl-1,3,5-triazin-2-yl)methanediamine.
| Compound Name | N,N'-bis(1-cyclohexyloxy-2,2,6,6-tetramethylpiperidin-4-yl)-N-methyl-N'-(4-methyl-6-morpholin-4-yl-1,3,5-triazin-2-yl)methanediamine |
|---|---|
| PubChem CID | 18716473 |
| Molecular Formula | C40H72N8O3 |
| Molecular Weight | 713.07 g/mol |
| Exact Mass | 712.57 |
| IUPAC Name | N,N'-bis(1-cyclohexyloxy-2,2,6,6-tetramethylpiperidin-4-yl)-N-methyl-N'-(4-methyl-6-morpholin-4-yl-1,3,5-triazin-2-yl)methanediamine |
| SMILES | Cc1nc(N2CCOCC2)nc(N(CN(C)C2CC(C)(C)N(OC3CCCCC3)C(C)(C)C2)C2CC(C)(C)N(OC3CCCCC3)C(C)(C)C2)n1 |
| InChI | InChI=1S/C40H72N8O3/c1-30-41-35(45-21-23-49-24-22-45)43-36(42-30)46(32-27-39(6,7)48(40(8,9)28-32)51-34-19-15-12-16-20-34)29-44(10)31-25-37(2,3)47(38(4,5)26-31)50-33-17-13-11-14-18-33/h31-34H,11-29H2,1-10H3 |
| InChIKey | VAJYOLAKKLOSLV-UHFFFAOYSA-N |
| XLogP | 7.28 |
| TPSA | 82.56 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 51 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 713.07 |
| LogP ≤ 5 | 7.28 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|