C21H44N4 — CID 18716477
N,N'-dimethyl-N,N'-bis(2,2,6,6-tetramethylpiperidin-4-yl)methanediamine (PubChem CID 18716477) has the molecular formula C21H44N4 and a molecular weight of 352.61 g/mol. Its IUPAC name is N,N'-dimethyl-N,N'-bis(2,2,6,6-tetramethylpiperidin-4-yl)methanediamine.
| Compound Name | N,N'-dimethyl-N,N'-bis(2,2,6,6-tetramethylpiperidin-4-yl)methanediamine |
|---|---|
| PubChem CID | 18716477 |
| Molecular Formula | C21H44N4 |
| Molecular Weight | 352.61 g/mol |
| Exact Mass | 352.36 |
| IUPAC Name | N,N'-dimethyl-N,N'-bis(2,2,6,6-tetramethylpiperidin-4-yl)methanediamine |
| SMILES | CN(CN(C)C1CC(C)(C)NC(C)(C)C1)C1CC(C)(C)NC(C)(C)C1 |
| InChI | InChI=1S/C21H44N4/c1-18(2)11-16(12-19(3,4)22-18)24(9)15-25(10)17-13-20(5,6)23-21(7,8)14-17/h16-17,22-23H,11-15H2,1-10H3 |
| InChIKey | PFOMCIFSSCGMHC-UHFFFAOYSA-N |
| XLogP | 3.43 |
| TPSA | 30.54 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 352.61 |
| LogP ≤ 5 | 3.43 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|