C18H38N2 — CID 18716552
2-N,4,11,11-tetramethyl-8-methylidenetridecane-2,4-diamine (PubChem CID 18716552) has the molecular formula C18H38N2 and a molecular weight of 282.52 g/mol. Its IUPAC name is 2-N,4,11,11-tetramethyl-8-methylidenetridecane-2,4-diamine.
| Compound Name | 2-N,4,11,11-tetramethyl-8-methylidenetridecane-2,4-diamine |
|---|---|
| PubChem CID | 18716552 |
| Molecular Formula | C18H38N2 |
| Molecular Weight | 282.52 g/mol |
| Exact Mass | 282.30 |
| IUPAC Name | 2-N,4,11,11-tetramethyl-8-methylidenetridecane-2,4-diamine |
| SMILES | C=C(CCCC(C)(N)CC(C)NC)CCC(C)(C)CC |
| InChI | InChI=1S/C18H38N2/c1-8-17(4,5)13-11-15(2)10-9-12-18(6,19)14-16(3)20-7/h16,20H,2,8-14,19H2,1,3-7H3 |
| InChIKey | FOEJEKAERKPJRK-UHFFFAOYSA-N |
| XLogP | 4.64 |
| TPSA | 38.05 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 282.52 |
| LogP ≤ 5 | 4.64 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|