About CID 18716724
CID 18716724 (PubChem CID 18716724) has the molecular formula C53H90O14Si3
and a molecular weight of 1035.55 g/mol.
Molecular Properties
| Compound Name | CID 18716724 |
| PubChem CID | 18716724 |
| Molecular Formula | C53H90O14Si3 |
| Molecular Weight | 1035.55 g/mol |
| Exact Mass | 1034.56 |
| IUPAC Name | — |
| SMILES | CCC1C(=O)OC(=O)C1CCC1C(CCC2C3CC(C(=O)OC(C)(C)C)C(C3)C2CCC(C)(CC)C(=O)OCCC[Si](C)(O[Si]C)O[Si](C)(C)C)C2CC1C(C(=O)OCC(CC)(CC)CO)C2C(=O)O |
| InChI | InChI=1S/C53H90O14Si3/c1-14-33-38(47(58)64-46(33)57)22-21-36-35(40-29-41(36)44(43(40)45(55)56)49(60)63-31-53(16-3,17-4)30-54)20-19-34-32-27-39(42(28-32)48(59)65-51(5,6)7)37(34)23-24-52(8,15-2)50(61)62-25-18-26-70(13,66-68-9)67-69(10,11)12/h32-44,54H,14-31H2,1-13H3,(H,55,56) |
| InChIKey | KJJHKISJHSOTFX-UHFFFAOYSA-N |
| XLogP | 9.78 |
| TPSA | 198.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 13 |
| Rotatable Bonds | 28 |
| Heavy Atoms | 70 |
| Complexity | — |
Lipinski Rule of Five
3 violations
| Rule | Value |
| MW ≤ 500 | 1035.55 |
| LogP ≤ 5 | 9.78 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 13 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze CID 18716724 with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of CID 18716724?
The IUPAC name of CID 18716724 (CID 18716724) is not available.
What is the SMILES notation for CID 18716724?
The canonical SMILES for CID 18716724 is CCC1C(=O)OC(=O)C1CCC1C(CCC2C3CC(C(=O)OC(C)(C)C)C(C3)C2CCC(C)(CC)C(=O)OCCC[Si](C)(O[Si]C)O[Si](C)(C)C)C2CC1C(C(=O)OCC(CC)(CC)CO)C2C(=O)O.
What is the InChIKey of CID 18716724?
The InChIKey is KJJHKISJHSOTFX-UHFFFAOYSA-N. The full InChI is InChI=1S/C53H90O14Si3/c1-14-33-38(47(58)64-46(33)57)22-21-36-35(40-29-41(36)44(43(40)45(55)56)49(60)63-31-53(16-3,17-4)30-54)20-19-34-32-27-39(42(28-32)48(59)65-51(5,6)7)37(34)23-24-52(8,15-2)50(61)62-25-18-26-70(13,66-68-9)67-69(10,11)12/h32-44,54H,14-31H2,1-13H3,(H,55,56).
What are the key properties of CID 18716724?
CID 18716724 has a molecular weight of 1035.55 g/mol, XLogP of 9.78, 28 rotatable bonds, 2 hydrogen bond donors, and 13 hydrogen bond acceptors.
Where does this data come from?
All data for CID 18716724 is sourced from PubChem (CID 18716724), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).