About 1,2,3,4-tetramethyl-5-methylidene-1,2,4-triazolidine
1,2,3,4-tetramethyl-5-methylidene-1,2,4-triazolidine (PubChem CID 18717180) has the molecular formula C7H15N3
and a molecular weight of 141.22 g/mol. Its IUPAC name is 1,2,3,4-tetramethyl-5-methylidene-1,2,4-triazolidine.
Analyze 1,2,3,4-tetramethyl-5-methylidene-1,2,4-triazolidine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1,2,3,4-tetramethyl-5-methylidene-1,2,4-triazolidine?
The IUPAC name of 1,2,3,4-tetramethyl-5-methylidene-1,2,4-triazolidine (CID 18717180) is 1,2,3,4-tetramethyl-5-methylidene-1,2,4-triazolidine.
What is the SMILES notation for 1,2,3,4-tetramethyl-5-methylidene-1,2,4-triazolidine?
The canonical SMILES for 1,2,3,4-tetramethyl-5-methylidene-1,2,4-triazolidine is C=C1N(C)C(C)N(C)N1C.
What is the InChIKey of 1,2,3,4-tetramethyl-5-methylidene-1,2,4-triazolidine?
The InChIKey is LGVZGVXRLDDGTQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H15N3/c1-6-8(3)7(2)10(5)9(6)4/h7H,1H2,2-5H3.
What are the key properties of 1,2,3,4-tetramethyl-5-methylidene-1,2,4-triazolidine?
1,2,3,4-tetramethyl-5-methylidene-1,2,4-triazolidine has a molecular weight of 141.22 g/mol, XLogP of 0.53, 0 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 1,2,3,4-tetramethyl-5-methylidene-1,2,4-triazolidine is sourced from PubChem (CID 18717180), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).