About 1-(3-methylbuta-1,3-dien-2-yloxy)hexa-2,4-diyne
1-(3-methylbuta-1,3-dien-2-yloxy)hexa-2,4-diyne (PubChem CID 18717190) has the molecular formula C11H11O-
and a molecular weight of 159.21 g/mol. Its IUPAC name is 1-(3-methylbuta-1,3-dien-2-yloxy)hexa-2,4-diyne.
Molecular Properties
| Compound Name | 1-(3-methylbuta-1,3-dien-2-yloxy)hexa-2,4-diyne |
| PubChem CID | 18717190 |
| Molecular Formula | C11H11O- |
| Molecular Weight | 159.21 g/mol |
| Exact Mass | 159.08 |
| IUPAC Name | 1-(3-methylbuta-1,3-dien-2-yloxy)hexa-2,4-diyne |
| SMILES | C=C(C)C(=C)OCC#CC#C[CH2-] |
| InChI | InChI=1S/C11H11O/c1-5-6-7-8-9-12-11(4)10(2)3/h1-2,4,9H2,3H3/q-1 |
| InChIKey | HKRQUFPSARYLKE-UHFFFAOYSA-N |
| XLogP | 1.93 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 159.21 |
| LogP ≤ 5 | 1.93 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|
Analyze 1-(3-methylbuta-1,3-dien-2-yloxy)hexa-2,4-diyne with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-(3-methylbuta-1,3-dien-2-yloxy)hexa-2,4-diyne?
The IUPAC name of 1-(3-methylbuta-1,3-dien-2-yloxy)hexa-2,4-diyne (CID 18717190) is 1-(3-methylbuta-1,3-dien-2-yloxy)hexa-2,4-diyne.
What is the SMILES notation for 1-(3-methylbuta-1,3-dien-2-yloxy)hexa-2,4-diyne?
The canonical SMILES for 1-(3-methylbuta-1,3-dien-2-yloxy)hexa-2,4-diyne is C=C(C)C(=C)OCC#CC#C[CH2-].
What is the InChIKey of 1-(3-methylbuta-1,3-dien-2-yloxy)hexa-2,4-diyne?
The InChIKey is HKRQUFPSARYLKE-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H11O/c1-5-6-7-8-9-12-11(4)10(2)3/h1-2,4,9H2,3H3/q-1.
What are the key properties of 1-(3-methylbuta-1,3-dien-2-yloxy)hexa-2,4-diyne?
1-(3-methylbuta-1,3-dien-2-yloxy)hexa-2,4-diyne has a molecular weight of 159.21 g/mol, XLogP of 1.93, 3 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 1-(3-methylbuta-1,3-dien-2-yloxy)hexa-2,4-diyne is sourced from PubChem (CID 18717190), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).