C9H14N2 — CID 18717200
1,5,6-trimethyl-2,4-dimethylidenepyrimidine (PubChem CID 18717200) has the molecular formula C9H14N2 and a molecular weight of 150.22 g/mol. Its IUPAC name is 1,5,6-trimethyl-2,4-dimethylidenepyrimidine.
| Compound Name | 1,5,6-trimethyl-2,4-dimethylidenepyrimidine |
|---|---|
| PubChem CID | 18717200 |
| Molecular Formula | C9H14N2 |
| Molecular Weight | 150.22 g/mol |
| Exact Mass | 150.12 |
| IUPAC Name | 1,5,6-trimethyl-2,4-dimethylidenepyrimidine |
| SMILES | C=C1NC(=C)N(C)C(C)=C1C |
| InChI | InChI=1S/C9H14N2/c1-6-7(2)10-9(4)11(5)8(6)3/h10H,2,4H2,1,3,5H3 |
| InChIKey | HTTVZEWNZIEGFJ-UHFFFAOYSA-N |
| XLogP | 1.80 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 150.22 |
| LogP ≤ 5 | 1.80 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |