C14H18N4O2 — CID 18717210
1-methyl-2-prop-2-enyl-4-(3,5,6-trimethyl-2-pyridinyl)-1,2,4-triazolidine-3,5-dione (PubChem CID 18717210) has the molecular formula C14H18N4O2 and a molecular weight of 274.32 g/mol. Its IUPAC name is 1-methyl-2-prop-2-enyl-4-(3,5,6-trimethyl-2-pyridinyl)-1,2,4-triazolidine-3,5-dione.
| Compound Name | 1-methyl-2-prop-2-enyl-4-(3,5,6-trimethyl-2-pyridinyl)-1,2,4-triazolidine-3,5-dione |
|---|---|
| PubChem CID | 18717210 |
| Molecular Formula | C14H18N4O2 |
| Molecular Weight | 274.32 g/mol |
| Exact Mass | 274.14 |
| IUPAC Name | 1-methyl-2-prop-2-enyl-4-(3,5,6-trimethyl-2-pyridinyl)-1,2,4-triazolidine-3,5-dione |
| SMILES | C=CCn1c(=O)n(-c2nc(C)c(C)cc2C)c(=O)n1C |
| InChI | InChI=1S/C14H18N4O2/c1-6-7-17-14(20)18(13(19)16(17)5)12-10(3)8-9(2)11(4)15-12/h6,8H,1,7H2,2-5H3 |
| InChIKey | QJXLTTUBQQJXPX-UHFFFAOYSA-N |
| XLogP | 0.84 |
| TPSA | 61.82 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 274.32 |
| LogP ≤ 5 | 0.84 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|