C13H15ClN4O2 — CID 18717211
4-(5-chloro-3,6-dimethyl-2-pyridinyl)-1-methyl-2-prop-2-enyl-1,2,4-triazolidine-3,5-dione (PubChem CID 18717211) has the molecular formula C13H15ClN4O2 and a molecular weight of 294.74 g/mol. Its IUPAC name is 4-(5-chloro-3,6-dimethyl-2-pyridinyl)-1-methyl-2-prop-2-enyl-1,2,4-triazolidine-3,5-dione.
| Compound Name | 4-(5-chloro-3,6-dimethyl-2-pyridinyl)-1-methyl-2-prop-2-enyl-1,2,4-triazolidine-3,5-dione |
|---|---|
| PubChem CID | 18717211 |
| Molecular Formula | C13H15ClN4O2 |
| Molecular Weight | 294.74 g/mol |
| Exact Mass | 294.09 |
| IUPAC Name | 4-(5-chloro-3,6-dimethyl-2-pyridinyl)-1-methyl-2-prop-2-enyl-1,2,4-triazolidine-3,5-dione |
| SMILES | C=CCn1c(=O)n(-c2nc(C)c(Cl)cc2C)c(=O)n1C |
| InChI | InChI=1S/C13H15ClN4O2/c1-5-6-17-13(20)18(12(19)16(17)4)11-8(2)7-10(14)9(3)15-11/h5,7H,1,6H2,2-4H3 |
| InChIKey | VSFOSTIRHBSKBE-UHFFFAOYSA-N |
| XLogP | 1.19 |
| TPSA | 61.82 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 294.74 |
| LogP ≤ 5 | 1.19 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|