C13H15ClN4S2 — CID 18717212
4-(5-chloro-3,6-dimethyl-2-pyridinyl)-1-methyl-2-prop-2-enyl-1,2,4-triazolidine-3,5-dithione (PubChem CID 18717212) has the molecular formula C13H15ClN4S2 and a molecular weight of 326.88 g/mol. Its IUPAC name is 4-(5-chloro-3,6-dimethyl-2-pyridinyl)-1-methyl-2-prop-2-enyl-1,2,4-triazolidine-3,5-dithione.
| Compound Name | 4-(5-chloro-3,6-dimethyl-2-pyridinyl)-1-methyl-2-prop-2-enyl-1,2,4-triazolidine-3,5-dithione |
|---|---|
| PubChem CID | 18717212 |
| Molecular Formula | C13H15ClN4S2 |
| Molecular Weight | 326.88 g/mol |
| Exact Mass | 326.04 |
| IUPAC Name | 4-(5-chloro-3,6-dimethyl-2-pyridinyl)-1-methyl-2-prop-2-enyl-1,2,4-triazolidine-3,5-dithione |
| SMILES | C=CCn1c(=S)n(-c2nc(C)c(Cl)cc2C)c(=S)n1C |
| InChI | InChI=1S/C13H15ClN4S2/c1-5-6-17-13(20)18(12(19)16(17)4)11-8(2)7-10(14)9(3)15-11/h5,7H,1,6H2,2-4H3 |
| InChIKey | VFNRKAVVRPOLOA-UHFFFAOYSA-N |
| XLogP | 3.93 |
| TPSA | 27.68 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 326.88 |
| LogP ≤ 5 | 3.93 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|