C13H14F3N3O2 — CID 18717293
3-[3,6-dimethyl-5-(trifluoromethyl)-2-pyridinyl]-1,5-dimethylimidazolidine-2,4-dione (PubChem CID 18717293) has the molecular formula C13H14F3N3O2 and a molecular weight of 301.27 g/mol. Its IUPAC name is 3-[3,6-dimethyl-5-(trifluoromethyl)-2-pyridinyl]-1,5-dimethylimidazolidine-2,4-dione.
| Compound Name | 3-[3,6-dimethyl-5-(trifluoromethyl)-2-pyridinyl]-1,5-dimethylimidazolidine-2,4-dione |
|---|---|
| PubChem CID | 18717293 |
| Molecular Formula | C13H14F3N3O2 |
| Molecular Weight | 301.27 g/mol |
| Exact Mass | 301.10 |
| IUPAC Name | 3-[3,6-dimethyl-5-(trifluoromethyl)-2-pyridinyl]-1,5-dimethylimidazolidine-2,4-dione |
| SMILES | Cc1cc(C(F)(F)F)c(C)nc1N1C(=O)C(C)N(C)C1=O |
| InChI | InChI=1S/C13H14F3N3O2/c1-6-5-9(13(14,15)16)7(2)17-10(6)19-11(20)8(3)18(4)12(19)21/h5,8H,1-4H3 |
| InChIKey | HMDLMOCZUIJHRX-UHFFFAOYSA-N |
| XLogP | 2.50 |
| TPSA | 53.51 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 301.27 |
| LogP ≤ 5 | 2.50 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|