C16H17FN4O2 — CID 18717375
7-fluoro-2-(5-isocyano-3,6-dimethyl-2-pyridinyl)-7-methyl-5,6,8,8a-tetrahydroimidazo[1,5-a]pyridine-1,3-dione (PubChem CID 18717375) has the molecular formula C16H17FN4O2 and a molecular weight of 316.34 g/mol. Its IUPAC name is 7-fluoro-2-(5-isocyano-3,6-dimethyl-2-pyridinyl)-7-methyl-5,6,8,8a-tetrahydroimidazo[1,5-a]pyridine-1,3-dione.
| Compound Name | 7-fluoro-2-(5-isocyano-3,6-dimethyl-2-pyridinyl)-7-methyl-5,6,8,8a-tetrahydroimidazo[1,5-a]pyridine-1,3-dione |
|---|---|
| PubChem CID | 18717375 |
| Molecular Formula | C16H17FN4O2 |
| Molecular Weight | 316.34 g/mol |
| Exact Mass | 316.13 |
| IUPAC Name | 7-fluoro-2-(5-isocyano-3,6-dimethyl-2-pyridinyl)-7-methyl-5,6,8,8a-tetrahydroimidazo[1,5-a]pyridine-1,3-dione |
| SMILES | [C-]#[N+]c1cc(C)c(N2C(=O)C3CC(C)(F)CCN3C2=O)nc1C |
| InChI | InChI=1S/C16H17FN4O2/c1-9-7-11(18-4)10(2)19-13(9)21-14(22)12-8-16(3,17)5-6-20(12)15(21)23/h7,12H,5-6,8H2,1-3H3 |
| InChIKey | QFUVBWKXQCTBNU-UHFFFAOYSA-N |
| XLogP | 2.91 |
| TPSA | 57.87 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 316.34 |
| LogP ≤ 5 | 2.91 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|