C16H17FN4O3 — CID 18717409
6-(7-fluoro-7-methyl-1,3-dioxo-5,6,8,8a-tetrahydroimidazo[1,5-a]pyridin-2-yl)-2,5-dimethyl-1-oxidopyridin-1-ium-3-carbonitrile (PubChem CID 18717409) has the molecular formula C16H17FN4O3 and a molecular weight of 332.34 g/mol. Its IUPAC name is 6-(7-fluoro-7-methyl-1,3-dioxo-5,6,8,8a-tetrahydroimidazo[1,5-a]pyridin-2-yl)-2,5-dimethyl-1-oxidopyridin-1-ium-3-carbonitrile.
| Compound Name | 6-(7-fluoro-7-methyl-1,3-dioxo-5,6,8,8a-tetrahydroimidazo[1,5-a]pyridin-2-yl)-2,5-dimethyl-1-oxidopyridin-1-ium-3-carbonitrile |
|---|---|
| PubChem CID | 18717409 |
| Molecular Formula | C16H17FN4O3 |
| Molecular Weight | 332.34 g/mol |
| Exact Mass | 332.13 |
| IUPAC Name | 6-(7-fluoro-7-methyl-1,3-dioxo-5,6,8,8a-tetrahydroimidazo[1,5-a]pyridin-2-yl)-2,5-dimethyl-1-oxidopyridin-1-ium-3-carbonitrile |
| SMILES | Cc1cc(C#N)c(C)[n+]([O-])c1N1C(=O)C2CC(C)(F)CCN2C1=O |
| InChI | InChI=1S/C16H17FN4O3/c1-9-6-11(8-18)10(2)21(24)13(9)20-14(22)12-7-16(3,17)4-5-19(12)15(20)23/h6,12H,4-5,7H2,1-3H3 |
| InChIKey | CAQGZEFCYKBPBZ-UHFFFAOYSA-N |
| XLogP | 1.47 |
| TPSA | 91.35 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 332.34 |
| LogP ≤ 5 | 1.47 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'}, {'alert_name': 'N_oxide', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|