C15H16F3N3O2 — CID 18717436
2-[3,6-dimethyl-5-(trifluoromethyl)-2-pyridinyl]-6,7,8,8a-tetrahydro-5H-imidazo[1,5-a]pyridine-1,3-dione (PubChem CID 18717436) has the molecular formula C15H16F3N3O2 and a molecular weight of 327.31 g/mol. Its IUPAC name is 2-[3,6-dimethyl-5-(trifluoromethyl)-2-pyridinyl]-6,7,8,8a-tetrahydro-5H-imidazo[1,5-a]pyridine-1,3-dione.
| Compound Name | 2-[3,6-dimethyl-5-(trifluoromethyl)-2-pyridinyl]-6,7,8,8a-tetrahydro-5H-imidazo[1,5-a]pyridine-1,3-dione |
|---|---|
| PubChem CID | 18717436 |
| Molecular Formula | C15H16F3N3O2 |
| Molecular Weight | 327.31 g/mol |
| Exact Mass | 327.12 |
| IUPAC Name | 2-[3,6-dimethyl-5-(trifluoromethyl)-2-pyridinyl]-6,7,8,8a-tetrahydro-5H-imidazo[1,5-a]pyridine-1,3-dione |
| SMILES | Cc1cc(C(F)(F)F)c(C)nc1N1C(=O)C2CCCCN2C1=O |
| InChI | InChI=1S/C15H16F3N3O2/c1-8-7-10(15(16,17)18)9(2)19-12(8)21-13(22)11-5-3-4-6-20(11)14(21)23/h7,11H,3-6H2,1-2H3 |
| InChIKey | PYXUAIAAVDBGGU-UHFFFAOYSA-N |
| XLogP | 3.04 |
| TPSA | 53.51 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 327.31 |
| LogP ≤ 5 | 3.04 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|