C16H18ClF2N3O2 — CID 18717441
2-(5-chloro-3,6-dimethyl-2-pyridinyl)-7-(1,1-difluoroethyl)-6,7,8,8a-tetrahydro-5H-imidazo[1,5-a]pyridine-1,3-dione (PubChem CID 18717441) has the molecular formula C16H18ClF2N3O2 and a molecular weight of 357.79 g/mol. Its IUPAC name is 2-(5-chloro-3,6-dimethyl-2-pyridinyl)-7-(1,1-difluoroethyl)-6,7,8,8a-tetrahydro-5H-imidazo[1,5-a]pyridine-1,3-dione.
| Compound Name | 2-(5-chloro-3,6-dimethyl-2-pyridinyl)-7-(1,1-difluoroethyl)-6,7,8,8a-tetrahydro-5H-imidazo[1,5-a]pyridine-1,3-dione |
|---|---|
| PubChem CID | 18717441 |
| Molecular Formula | C16H18ClF2N3O2 |
| Molecular Weight | 357.79 g/mol |
| Exact Mass | 357.11 |
| IUPAC Name | 2-(5-chloro-3,6-dimethyl-2-pyridinyl)-7-(1,1-difluoroethyl)-6,7,8,8a-tetrahydro-5H-imidazo[1,5-a]pyridine-1,3-dione |
| SMILES | Cc1cc(Cl)c(C)nc1N1C(=O)C2CC(C(C)(F)F)CCN2C1=O |
| InChI | InChI=1S/C16H18ClF2N3O2/c1-8-6-11(17)9(2)20-13(8)22-14(23)12-7-10(16(3,18)19)4-5-21(12)15(22)24/h6,10,12H,4-5,7H2,1-3H3 |
| InChIKey | CHCDEVOQVJQKNJ-UHFFFAOYSA-N |
| XLogP | 3.55 |
| TPSA | 53.51 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 357.79 |
| LogP ≤ 5 | 3.55 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|