C14H17N5O4S — CID 18717456
2-[3,6-dimethyl-5-(methylideneamino)-2-pyridinyl]-7,7-dioxo-5,6,8,9-tetrahydro-[1,2,4]triazolo[1,2-d][1,4,5]thiadiazepine-1,3-dione (PubChem CID 18717456) has the molecular formula C14H17N5O4S and a molecular weight of 351.39 g/mol. Its IUPAC name is 2-[3,6-dimethyl-5-(methylideneamino)-2-pyridinyl]-7,7-dioxo-5,6,8,9-tetrahydro-[1,2,4]triazolo[1,2-d][1,4,5]thiadiazepine-1,3-dione.
| Compound Name | 2-[3,6-dimethyl-5-(methylideneamino)-2-pyridinyl]-7,7-dioxo-5,6,8,9-tetrahydro-[1,2,4]triazolo[1,2-d][1,4,5]thiadiazepine-1,3-dione |
|---|---|
| PubChem CID | 18717456 |
| Molecular Formula | C14H17N5O4S |
| Molecular Weight | 351.39 g/mol |
| Exact Mass | 351.10 |
| IUPAC Name | 2-[3,6-dimethyl-5-(methylideneamino)-2-pyridinyl]-7,7-dioxo-5,6,8,9-tetrahydro-[1,2,4]triazolo[1,2-d][1,4,5]thiadiazepine-1,3-dione |
| SMILES | C=Nc1cc(C)c(-n2c(=O)n3n(c2=O)CCS(=O)(=O)CC3)nc1C |
| InChI | InChI=1S/C14H17N5O4S/c1-9-8-11(15-3)10(2)16-12(9)19-13(20)17-4-6-24(22,23)7-5-18(17)14(19)21/h8H,3-7H2,1-2H3 |
| InChIKey | LEYCOOXHJBTWDK-UHFFFAOYSA-N |
| XLogP | -0.43 |
| TPSA | 108.32 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 351.39 |
| LogP ≤ 5 | -0.43 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|