About 1,1-dimethylthiophene
1,1-dimethylthiophene (PubChem CID 18717507) has the molecular formula C6H10S
and a molecular weight of 114.21 g/mol. Its IUPAC name is 1,1-dimethylthiophene.
Molecular Properties
| Compound Name | 1,1-dimethylthiophene |
| PubChem CID | 18717507 |
| Molecular Formula | C6H10S |
| Molecular Weight | 114.21 g/mol |
| Exact Mass | 114.05 |
| IUPAC Name | 1,1-dimethylthiophene |
| SMILES | CS1(C)C=CC=C1 |
| InChI | InChI=1S/C6H10S/c1-7(2)5-3-4-6-7/h3-6H,1-2H3 |
| InChIKey | WIOCVQATSPXWPK-UHFFFAOYSA-N |
| XLogP | 2.09 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 7 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 114.21 |
| LogP ≤ 5 | 2.09 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Analyze 1,1-dimethylthiophene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1,1-dimethylthiophene?
The IUPAC name of 1,1-dimethylthiophene (CID 18717507) is 1,1-dimethylthiophene.
What is the SMILES notation for 1,1-dimethylthiophene?
The canonical SMILES for 1,1-dimethylthiophene is CS1(C)C=CC=C1.
What is the InChIKey of 1,1-dimethylthiophene?
The InChIKey is WIOCVQATSPXWPK-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H10S/c1-7(2)5-3-4-6-7/h3-6H,1-2H3.
What are the key properties of 1,1-dimethylthiophene?
1,1-dimethylthiophene has a molecular weight of 114.21 g/mol, XLogP of 2.09, 0 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for 1,1-dimethylthiophene is sourced from PubChem (CID 18717507), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).