About (E)-N-(3,4-dimethylhex-1-en-2-yl)-N-ethyloct-3-en-1-amine
(E)-N-(3,4-dimethylhex-1-en-2-yl)-N-ethyloct-3-en-1-amine (PubChem CID 18717522) has the molecular formula C18H35N
and a molecular weight of 265.48 g/mol. Its IUPAC name is (E)-N-(3,4-dimethylhex-1-en-2-yl)-N-ethyloct-3-en-1-amine.
Molecular Properties
| Compound Name | (E)-N-(3,4-dimethylhex-1-en-2-yl)-N-ethyloct-3-en-1-amine |
| PubChem CID | 18717522 |
| Molecular Formula | C18H35N |
| Molecular Weight | 265.48 g/mol |
| Exact Mass | 265.28 |
| IUPAC Name | (E)-N-(3,4-dimethylhex-1-en-2-yl)-N-ethyloct-3-en-1-amine |
| SMILES | C=C(C(C)C(C)CC)N(CC)CC/C=C/CCCC |
| InChI | InChI=1S/C18H35N/c1-7-10-11-12-13-14-15-19(9-3)18(6)17(5)16(4)8-2/h12-13,16-17H,6-11,14-15H2,1-5H3/b13-12+ |
| InChIKey | SGPRLYDIAKHIFO-OUKQBFOZSA-N |
| XLogP | 5.64 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 265.48 |
| LogP ≤ 5 | 5.64 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze (E)-N-(3,4-dimethylhex-1-en-2-yl)-N-ethyloct-3-en-1-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (E)-N-(3,4-dimethylhex-1-en-2-yl)-N-ethyloct-3-en-1-amine?
The IUPAC name of (E)-N-(3,4-dimethylhex-1-en-2-yl)-N-ethyloct-3-en-1-amine (CID 18717522) is (E)-N-(3,4-dimethylhex-1-en-2-yl)-N-ethyloct-3-en-1-amine.
What is the SMILES notation for (E)-N-(3,4-dimethylhex-1-en-2-yl)-N-ethyloct-3-en-1-amine?
The canonical SMILES for (E)-N-(3,4-dimethylhex-1-en-2-yl)-N-ethyloct-3-en-1-amine is C=C(C(C)C(C)CC)N(CC)CC/C=C/CCCC.
What is the InChIKey of (E)-N-(3,4-dimethylhex-1-en-2-yl)-N-ethyloct-3-en-1-amine?
The InChIKey is SGPRLYDIAKHIFO-OUKQBFOZSA-N. The full InChI is InChI=1S/C18H35N/c1-7-10-11-12-13-14-15-19(9-3)18(6)17(5)16(4)8-2/h12-13,16-17H,6-11,14-15H2,1-5H3/b13-12+.
What are the key properties of (E)-N-(3,4-dimethylhex-1-en-2-yl)-N-ethyloct-3-en-1-amine?
(E)-N-(3,4-dimethylhex-1-en-2-yl)-N-ethyloct-3-en-1-amine has a molecular weight of 265.48 g/mol, XLogP of 5.64, 11 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for (E)-N-(3,4-dimethylhex-1-en-2-yl)-N-ethyloct-3-en-1-amine is sourced from PubChem (CID 18717522), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).