About tert-butyl (2R,6S)-2-methyl-6-[(E)-pent-1-enyl]piperidine-1-carboxylate
tert-butyl (2R,6S)-2-methyl-6-[(E)-pent-1-enyl]piperidine-1-carboxylate (PubChem CID 18717999) has the molecular formula C16H29NO2
and a molecular weight of 267.41 g/mol. Its IUPAC name is tert-butyl (2R,6S)-2-methyl-6-[(E)-pent-1-enyl]piperidine-1-carboxylate.
Molecular Properties
| Compound Name | tert-butyl (2R,6S)-2-methyl-6-[(E)-pent-1-enyl]piperidine-1-carboxylate |
| PubChem CID | 18717999 |
| Molecular Formula | C16H29NO2 |
| Molecular Weight | 267.41 g/mol |
| Exact Mass | 267.22 |
| IUPAC Name | tert-butyl (2R,6S)-2-methyl-6-[(E)-pent-1-enyl]piperidine-1-carboxylate |
| SMILES | CCC/C=C/[C@@H]1CCC[C@@H](C)N1C(=O)OC(C)(C)C |
| InChI | InChI=1S/C16H29NO2/c1-6-7-8-11-14-12-9-10-13(2)17(14)15(18)19-16(3,4)5/h8,11,13-14H,6-7,9-10,12H2,1-5H3/b11-8+/t13-,14-/m1/s1 |
| InChIKey | CRAKWIOYXWQOHJ-DVFZLIDBSA-N |
| XLogP | 4.52 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 267.41 |
| LogP ≤ 5 | 4.52 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze tert-butyl (2R,6S)-2-methyl-6-[(E)-pent-1-enyl]piperidine-1-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of tert-butyl (2R,6S)-2-methyl-6-[(E)-pent-1-enyl]piperidine-1-carboxylate?
The IUPAC name of tert-butyl (2R,6S)-2-methyl-6-[(E)-pent-1-enyl]piperidine-1-carboxylate (CID 18717999) is tert-butyl (2R,6S)-2-methyl-6-[(E)-pent-1-enyl]piperidine-1-carboxylate.
What is the SMILES notation for tert-butyl (2R,6S)-2-methyl-6-[(E)-pent-1-enyl]piperidine-1-carboxylate?
The canonical SMILES for tert-butyl (2R,6S)-2-methyl-6-[(E)-pent-1-enyl]piperidine-1-carboxylate is CCC/C=C/[C@@H]1CCC[C@@H](C)N1C(=O)OC(C)(C)C.
What is the InChIKey of tert-butyl (2R,6S)-2-methyl-6-[(E)-pent-1-enyl]piperidine-1-carboxylate?
The InChIKey is CRAKWIOYXWQOHJ-DVFZLIDBSA-N. The full InChI is InChI=1S/C16H29NO2/c1-6-7-8-11-14-12-9-10-13(2)17(14)15(18)19-16(3,4)5/h8,11,13-14H,6-7,9-10,12H2,1-5H3/b11-8+/t13-,14-/m1/s1.
What are the key properties of tert-butyl (2R,6S)-2-methyl-6-[(E)-pent-1-enyl]piperidine-1-carboxylate?
tert-butyl (2R,6S)-2-methyl-6-[(E)-pent-1-enyl]piperidine-1-carboxylate has a molecular weight of 267.41 g/mol, XLogP of 4.52, 3 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for tert-butyl (2R,6S)-2-methyl-6-[(E)-pent-1-enyl]piperidine-1-carboxylate is sourced from PubChem (CID 18717999), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).