C5H11N3 — CID 18718018
1,1,2-trimethyl-3-methylideneguanidine (PubChem CID 18718018) has the molecular formula C5H11N3 and a molecular weight of 113.16 g/mol. Its IUPAC name is 1,1,2-trimethyl-3-methylideneguanidine.
| Compound Name | 1,1,2-trimethyl-3-methylideneguanidine |
|---|---|
| PubChem CID | 18718018 |
| Molecular Formula | C5H11N3 |
| Molecular Weight | 113.16 g/mol |
| Exact Mass | 113.10 |
| IUPAC Name | 1,1,2-trimethyl-3-methylideneguanidine |
| SMILES | C=N/C(=N\C)N(C)C |
| InChI | InChI=1S/C5H11N3/c1-6-5(7-2)8(3)4/h1H2,2-4H3/b7-5+ |
| InChIKey | FGGNJPUPCWCBCV-FNORWQNLSA-N |
| XLogP | 0.23 |
| TPSA | 27.96 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 8 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 113.16 |
| LogP ≤ 5 | 0.23 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|