C30H25N2O2S+ — CID 18718150
4-[4-(2-phenylmethoxyphenyl)thiophen-3-yl]-N-(pyridin-1-ium-3-ylmethyl)benzamide (PubChem CID 18718150) has the molecular formula C30H25N2O2S+ and a molecular weight of 477.61 g/mol. Its IUPAC name is 4-[4-(2-phenylmethoxyphenyl)thiophen-3-yl]-N-(pyridin-1-ium-3-ylmethyl)benzamide.
| Compound Name | 4-[4-(2-phenylmethoxyphenyl)thiophen-3-yl]-N-(pyridin-1-ium-3-ylmethyl)benzamide |
|---|---|
| PubChem CID | 18718150 |
| Molecular Formula | C30H25N2O2S+ |
| Molecular Weight | 477.61 g/mol |
| Exact Mass | 477.16 |
| IUPAC Name | 4-[4-(2-phenylmethoxyphenyl)thiophen-3-yl]-N-(pyridin-1-ium-3-ylmethyl)benzamide |
| SMILES | O=C(NCc1ccc[nH+]c1)c1ccc(-c2cscc2-c2ccccc2OCc2ccccc2)cc1 |
| InChI | InChI=1S/C30H24N2O2S/c33-30(32-18-23-9-6-16-31-17-23)25-14-12-24(13-15-25)27-20-35-21-28(27)26-10-4-5-11-29(26)34-19-22-7-2-1-3-8-22/h1-17,20-21H,18-19H2,(H,32,33)/p+1 |
| InChIKey | BHPDFIJCECKZJR-UHFFFAOYSA-O |
| XLogP | 6.41 |
| TPSA | 52.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 477.61 |
| LogP ≤ 5 | 6.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |