C20H23Cl2FeN3 — CID 18718483
dichloroiron;N'-(2,6-dimethylphenyl)-N-[2-(2,6-dimethylphenyl)iminoethyl]ethane-1,2-diimine (PubChem CID 18718483) has the molecular formula C20H23Cl2FeN3 and a molecular weight of 432.18 g/mol. Its IUPAC name is dichloroiron;N'-(2,6-dimethylphenyl)-N-[2-(2,6-dimethylphenyl)iminoethyl]ethane-1,2-diimine.
| Compound Name | dichloroiron;N'-(2,6-dimethylphenyl)-N-[2-(2,6-dimethylphenyl)iminoethyl]ethane-1,2-diimine |
|---|---|
| PubChem CID | 18718483 |
| Molecular Formula | C20H23Cl2FeN3 |
| Molecular Weight | 432.18 g/mol |
| Exact Mass | 431.06 |
| IUPAC Name | dichloroiron;N'-(2,6-dimethylphenyl)-N-[2-(2,6-dimethylphenyl)iminoethyl]ethane-1,2-diimine |
| SMILES | Cc1cccc(C)c1/N=C/C=N\C/C=N/c1c(C)cccc1C.Cl[Fe]Cl |
| InChI | InChI=1S/C20H23N3.2ClH.Fe/c1-15-7-5-8-16(2)19(15)22-13-11-21-12-14-23-20-17(3)9-6-10-18(20)4;;;/h5-11,13-14H,12H2,1-4H3;2*1H;/q;;;+2/p-2/b21-11-,22-13+,23-14+;;; |
| InChIKey | QQQMOUCDPGUPQZ-ZLYDCKJZSA-L |
| XLogP | 6.47 |
| TPSA | 37.08 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 432.18 |
| LogP ≤ 5 | 6.47 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|