C24H31Cl2FeN3 — CID 18718503
dichloroiron;2-N-(2,4,6-trimethylphenyl)-1-N-[2-(2,4,6-trimethylphenyl)iminopropyl]propane-1,2-diimine (PubChem CID 18718503) has the molecular formula C24H31Cl2FeN3 and a molecular weight of 488.28 g/mol. Its IUPAC name is dichloroiron;2-N-(2,4,6-trimethylphenyl)-1-N-[2-(2,4,6-trimethylphenyl)iminopropyl]propane-1,2-diimine.
| Compound Name | dichloroiron;2-N-(2,4,6-trimethylphenyl)-1-N-[2-(2,4,6-trimethylphenyl)iminopropyl]propane-1,2-diimine |
|---|---|
| PubChem CID | 18718503 |
| Molecular Formula | C24H31Cl2FeN3 |
| Molecular Weight | 488.28 g/mol |
| Exact Mass | 487.12 |
| IUPAC Name | dichloroiron;2-N-(2,4,6-trimethylphenyl)-1-N-[2-(2,4,6-trimethylphenyl)iminopropyl]propane-1,2-diimine |
| SMILES | CC(/C=N\C/C(C)=N/c1c(C)cc(C)cc1C)=N\c1c(C)cc(C)cc1C.Cl[Fe]Cl |
| InChI | InChI=1S/C24H31N3.2ClH.Fe/c1-15-9-17(3)23(18(4)10-15)26-21(7)13-25-14-22(8)27-24-19(5)11-16(2)12-20(24)6;;;/h9-13H,14H2,1-8H3;2*1H;/q;;;+2/p-2/b25-13-,26-21+,27-22+;;; |
| InChIKey | QWJCWCOFXOXQKI-NPBVNAEISA-L |
| XLogP | 7.87 |
| TPSA | 37.08 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 488.28 |
| LogP ≤ 5 | 7.87 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|