C26H35Cl2FeN3O2 — CID 18718519
dichloroiron;methyl (1E)-N-[1-methoxy-2-(2,4,6-trimethylphenyl)iminopropyl]-2-(2,4,6-trimethylphenyl)iminopropanimidate (PubChem CID 18718519) has the molecular formula C26H35Cl2FeN3O2 and a molecular weight of 548.34 g/mol. Its IUPAC name is dichloroiron;methyl (1E)-N-[1-methoxy-2-(2,4,6-trimethylphenyl)iminopropyl]-2-(2,4,6-trimethylphenyl)iminopropanimidate.
| Compound Name | dichloroiron;methyl (1E)-N-[1-methoxy-2-(2,4,6-trimethylphenyl)iminopropyl]-2-(2,4,6-trimethylphenyl)iminopropanimidate |
|---|---|
| PubChem CID | 18718519 |
| Molecular Formula | C26H35Cl2FeN3O2 |
| Molecular Weight | 548.34 g/mol |
| Exact Mass | 547.15 |
| IUPAC Name | dichloroiron;methyl (1E)-N-[1-methoxy-2-(2,4,6-trimethylphenyl)iminopropyl]-2-(2,4,6-trimethylphenyl)iminopropanimidate |
| SMILES | COC(=N/C(OC)/C(C)=N/c1c(C)cc(C)cc1C)/C(C)=N/c1c(C)cc(C)cc1C.Cl[Fe]Cl |
| InChI | InChI=1S/C26H35N3O2.2ClH.Fe/c1-15-11-17(3)23(18(4)12-15)27-21(7)25(30-9)29-26(31-10)22(8)28-24-19(5)13-16(2)14-20(24)6;;;/h11-14,25H,1-10H3;2*1H;/q;;;+2/p-2/b27-21+,28-22+,29-26+;;; |
| InChIKey | JYTGIOXRGMJLFE-RDRPSQNLSA-L |
| XLogP | 7.82 |
| TPSA | 55.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 34 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 548.34 |
| LogP ≤ 5 | 7.82 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|