C23H31N3 — CID 18718526
N-methyl-2-(2,4,6-trimethylphenyl)imino-N-[2-(2,4,6-trimethylphenyl)iminoethyl]ethanamine (PubChem CID 18718526) has the molecular formula C23H31N3 and a molecular weight of 349.52 g/mol. Its IUPAC name is N-methyl-2-(2,4,6-trimethylphenyl)imino-N-[2-(2,4,6-trimethylphenyl)iminoethyl]ethanamine.
| Compound Name | N-methyl-2-(2,4,6-trimethylphenyl)imino-N-[2-(2,4,6-trimethylphenyl)iminoethyl]ethanamine |
|---|---|
| PubChem CID | 18718526 |
| Molecular Formula | C23H31N3 |
| Molecular Weight | 349.52 g/mol |
| Exact Mass | 349.25 |
| IUPAC Name | N-methyl-2-(2,4,6-trimethylphenyl)imino-N-[2-(2,4,6-trimethylphenyl)iminoethyl]ethanamine |
| SMILES | Cc1cc(C)c(/N=C/CN(C)C/C=N/c2c(C)cc(C)cc2C)c(C)c1 |
| InChI | InChI=1S/C23H31N3/c1-16-12-18(3)22(19(4)13-16)24-8-10-26(7)11-9-25-23-20(5)14-17(2)15-21(23)6/h8-9,12-15H,10-11H2,1-7H3/b24-8+,25-9+ |
| InChIKey | RUMQKMSULUITAS-IQEGOQEASA-N |
| XLogP | 5.57 |
| TPSA | 27.96 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 349.52 |
| LogP ≤ 5 | 5.57 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|