C22H23Br2FeN3 — CID 18718678
dibromoiron;N-(2,6-dimethylphenyl)-1-[5-[(2,6-dimethylphenyl)iminomethyl]-3H-pyrrol-2-yl]methanimine (PubChem CID 18718678) has the molecular formula C22H23Br2FeN3 and a molecular weight of 545.10 g/mol. Its IUPAC name is dibromoiron;N-(2,6-dimethylphenyl)-1-[5-[(2,6-dimethylphenyl)iminomethyl]-3H-pyrrol-2-yl]methanimine.
| Compound Name | dibromoiron;N-(2,6-dimethylphenyl)-1-[5-[(2,6-dimethylphenyl)iminomethyl]-3H-pyrrol-2-yl]methanimine |
|---|---|
| PubChem CID | 18718678 |
| Molecular Formula | C22H23Br2FeN3 |
| Molecular Weight | 545.10 g/mol |
| Exact Mass | 542.96 |
| IUPAC Name | dibromoiron;N-(2,6-dimethylphenyl)-1-[5-[(2,6-dimethylphenyl)iminomethyl]-3H-pyrrol-2-yl]methanimine |
| SMILES | Br[Fe]Br.Cc1cccc(C)c1/N=C/C1=CCC(/C=N/c2c(C)cccc2C)=N1 |
| InChI | InChI=1S/C22H23N3.2BrH.Fe/c1-15-7-5-8-16(2)21(15)23-13-19-11-12-20(25-19)14-24-22-17(3)9-6-10-18(22)4;;;/h5-11,13-14H,12H2,1-4H3;2*1H;/q;;;+2/p-2/b23-13+,24-14+;;; |
| InChIKey | RNCSPZRYKGTSNQ-IRGXHNTLSA-L |
| XLogP | 7.44 |
| TPSA | 37.08 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 545.10 |
| LogP ≤ 5 | 7.44 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|