C26H31Cl2FeN3 — CID 18719154
dichloroiron;1-[3,4-dimethyl-5-[(2,4,6-trimethylphenyl)iminomethyl]-3H-pyrrol-2-yl]-N-(2,4,6-trimethylphenyl)methanimine (PubChem CID 18719154) has the molecular formula C26H31Cl2FeN3 and a molecular weight of 512.31 g/mol. Its IUPAC name is dichloroiron;1-[3,4-dimethyl-5-[(2,4,6-trimethylphenyl)iminomethyl]-3H-pyrrol-2-yl]-N-(2,4,6-trimethylphenyl)methanimine.
| Compound Name | dichloroiron;1-[3,4-dimethyl-5-[(2,4,6-trimethylphenyl)iminomethyl]-3H-pyrrol-2-yl]-N-(2,4,6-trimethylphenyl)methanimine |
|---|---|
| PubChem CID | 18719154 |
| Molecular Formula | C26H31Cl2FeN3 |
| Molecular Weight | 512.31 g/mol |
| Exact Mass | 511.12 |
| IUPAC Name | dichloroiron;1-[3,4-dimethyl-5-[(2,4,6-trimethylphenyl)iminomethyl]-3H-pyrrol-2-yl]-N-(2,4,6-trimethylphenyl)methanimine |
| SMILES | CC1=C(/C=N/c2c(C)cc(C)cc2C)N=C(/C=N/c2c(C)cc(C)cc2C)C1C.Cl[Fe]Cl |
| InChI | InChI=1S/C26H31N3.2ClH.Fe/c1-15-9-17(3)25(18(4)10-15)27-13-23-21(7)22(8)24(29-23)14-28-26-19(5)11-16(2)12-20(26)6;;;/h9-14,21H,1-8H3;2*1H;/q;;;+2/p-2/b27-13+,28-14+;;; |
| InChIKey | NROFGPBWRKEXOB-IZFKIEQPSA-L |
| XLogP | 8.38 |
| TPSA | 37.08 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 32 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 512.31 |
| LogP ≤ 5 | 8.38 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|