About bis[2-(2,4,6-trimethylphenyl)iminoethyl]azanide;dichloroiron(1+)
bis[2-(2,4,6-trimethylphenyl)iminoethyl]azanide;dichloroiron(1+) (PubChem CID 18719207) has the molecular formula C22H28Cl2FeN3
and a molecular weight of 461.24 g/mol. Its IUPAC name is bis[2-(2,4,6-trimethylphenyl)iminoethyl]azanide;dichloroiron(1+).
Molecular Properties
| Compound Name | bis[2-(2,4,6-trimethylphenyl)iminoethyl]azanide;dichloroiron(1+) |
| PubChem CID | 18719207 |
| Molecular Formula | C22H28Cl2FeN3 |
| Molecular Weight | 461.24 g/mol |
| Exact Mass | 460.10 |
| IUPAC Name | bis[2-(2,4,6-trimethylphenyl)iminoethyl]azanide;dichloroiron(1+) |
| SMILES | Cc1cc(C)c(/N=C/C[N-]C/C=N/c2c(C)cc(C)cc2C)c(C)c1.Cl[Fe+]Cl |
| InChI | InChI=1S/C22H28N3.2ClH.Fe/c1-15-11-17(3)21(18(4)12-15)24-9-7-23-8-10-25-22-19(5)13-16(2)14-20(22)6;;;/h9-14H,7-8H2,1-6H3;2*1H;/q-1;;;+3/p-2/b24-9+,25-10+;;; |
| InChIKey | SACUBXKJAGCRTR-AYRDHOQPSA-L |
| XLogP | 7.39 |
| TPSA | 38.82 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 461.24 |
| LogP ≤ 5 | 7.39 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|
Analyze bis[2-(2,4,6-trimethylphenyl)iminoethyl]azanide;dichloroiron(1+) with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of bis[2-(2,4,6-trimethylphenyl)iminoethyl]azanide;dichloroiron(1+)?
The IUPAC name of bis[2-(2,4,6-trimethylphenyl)iminoethyl]azanide;dichloroiron(1+) (CID 18719207) is bis[2-(2,4,6-trimethylphenyl)iminoethyl]azanide;dichloroiron(1+).
What is the SMILES notation for bis[2-(2,4,6-trimethylphenyl)iminoethyl]azanide;dichloroiron(1+)?
The canonical SMILES for bis[2-(2,4,6-trimethylphenyl)iminoethyl]azanide;dichloroiron(1+) is Cc1cc(C)c(/N=C/C[N-]C/C=N/c2c(C)cc(C)cc2C)c(C)c1.Cl[Fe+]Cl.
What is the InChIKey of bis[2-(2,4,6-trimethylphenyl)iminoethyl]azanide;dichloroiron(1+)?
The InChIKey is SACUBXKJAGCRTR-AYRDHOQPSA-L. The full InChI is InChI=1S/C22H28N3.2ClH.Fe/c1-15-11-17(3)21(18(4)12-15)24-9-7-23-8-10-25-22-19(5)13-16(2)14-20(22)6;;;/h9-14H,7-8H2,1-6H3;2*1H;/q-1;;;+3/p-2/b24-9+,25-10+;;;.
What are the key properties of bis[2-(2,4,6-trimethylphenyl)iminoethyl]azanide;dichloroiron(1+)?
bis[2-(2,4,6-trimethylphenyl)iminoethyl]azanide;dichloroiron(1+) has a molecular weight of 461.24 g/mol, XLogP of 7.39, 6 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for bis[2-(2,4,6-trimethylphenyl)iminoethyl]azanide;dichloroiron(1+) is sourced from PubChem (CID 18719207), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).