About bis[2-(2,6-dimethylphenyl)imino-1-methoxyethyl]azanide;dichloroiron(1+)
bis[2-(2,6-dimethylphenyl)imino-1-methoxyethyl]azanide;dichloroiron(1+) (PubChem CID 18719212) has the molecular formula C22H28Cl2FeN3O2
and a molecular weight of 493.24 g/mol. Its IUPAC name is bis[2-(2,6-dimethylphenyl)imino-1-methoxyethyl]azanide;dichloroiron(1+).
Molecular Properties
| Compound Name | bis[2-(2,6-dimethylphenyl)imino-1-methoxyethyl]azanide;dichloroiron(1+) |
| PubChem CID | 18719212 |
| Molecular Formula | C22H28Cl2FeN3O2 |
| Molecular Weight | 493.24 g/mol |
| Exact Mass | 492.09 |
| IUPAC Name | bis[2-(2,6-dimethylphenyl)imino-1-methoxyethyl]azanide;dichloroiron(1+) |
| SMILES | COC(/C=N/c1c(C)cccc1C)[N-]C(/C=N/c1c(C)cccc1C)OC.Cl[Fe+]Cl |
| InChI | InChI=1S/C22H28N3O2.2ClH.Fe/c1-15-9-7-10-16(2)21(15)23-13-19(26-5)25-20(27-6)14-24-22-17(3)11-8-12-18(22)4;;;/h7-14,19-20H,1-6H3;2*1H;/q-1;;;+3/p-2/b23-13+,24-14+;;; |
| InChIKey | MVMPDCGVHGXKBK-IRGXHNTLSA-L |
| XLogP | 6.72 |
| TPSA | 57.28 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 493.24 |
| LogP ≤ 5 | 6.72 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|
Analyze bis[2-(2,6-dimethylphenyl)imino-1-methoxyethyl]azanide;dichloroiron(1+) with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of bis[2-(2,6-dimethylphenyl)imino-1-methoxyethyl]azanide;dichloroiron(1+)?
The IUPAC name of bis[2-(2,6-dimethylphenyl)imino-1-methoxyethyl]azanide;dichloroiron(1+) (CID 18719212) is bis[2-(2,6-dimethylphenyl)imino-1-methoxyethyl]azanide;dichloroiron(1+).
What is the SMILES notation for bis[2-(2,6-dimethylphenyl)imino-1-methoxyethyl]azanide;dichloroiron(1+)?
The canonical SMILES for bis[2-(2,6-dimethylphenyl)imino-1-methoxyethyl]azanide;dichloroiron(1+) is COC(/C=N/c1c(C)cccc1C)[N-]C(/C=N/c1c(C)cccc1C)OC.Cl[Fe+]Cl.
What is the InChIKey of bis[2-(2,6-dimethylphenyl)imino-1-methoxyethyl]azanide;dichloroiron(1+)?
The InChIKey is MVMPDCGVHGXKBK-IRGXHNTLSA-L. The full InChI is InChI=1S/C22H28N3O2.2ClH.Fe/c1-15-9-7-10-16(2)21(15)23-13-19(26-5)25-20(27-6)14-24-22-17(3)11-8-12-18(22)4;;;/h7-14,19-20H,1-6H3;2*1H;/q-1;;;+3/p-2/b23-13+,24-14+;;;.
What are the key properties of bis[2-(2,6-dimethylphenyl)imino-1-methoxyethyl]azanide;dichloroiron(1+)?
bis[2-(2,6-dimethylphenyl)imino-1-methoxyethyl]azanide;dichloroiron(1+) has a molecular weight of 493.24 g/mol, XLogP of 6.72, 8 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for bis[2-(2,6-dimethylphenyl)imino-1-methoxyethyl]azanide;dichloroiron(1+) is sourced from PubChem (CID 18719212), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).