C20H28N4O6 — CID 18719610
1-[4-(2,3-dioxo-3-piperidin-1-ylpropanoyl)piperazin-1-yl]-3-piperidin-1-ylpropane-1,2,3-trione (PubChem CID 18719610) has the molecular formula C20H28N4O6 and a molecular weight of 420.47 g/mol. Its IUPAC name is 1-[4-(2,3-dioxo-3-piperidin-1-ylpropanoyl)piperazin-1-yl]-3-piperidin-1-ylpropane-1,2,3-trione.
| Compound Name | 1-[4-(2,3-dioxo-3-piperidin-1-ylpropanoyl)piperazin-1-yl]-3-piperidin-1-ylpropane-1,2,3-trione |
|---|---|
| PubChem CID | 18719610 |
| Molecular Formula | C20H28N4O6 |
| Molecular Weight | 420.47 g/mol |
| Exact Mass | 420.20 |
| IUPAC Name | 1-[4-(2,3-dioxo-3-piperidin-1-ylpropanoyl)piperazin-1-yl]-3-piperidin-1-ylpropane-1,2,3-trione |
| SMILES | O=C(C(=O)N1CCCCC1)C(=O)N1CCN(C(=O)C(=O)C(=O)N2CCCCC2)CC1 |
| InChI | InChI=1S/C20H28N4O6/c25-15(17(27)21-7-3-1-4-8-21)19(29)23-11-13-24(14-12-23)20(30)16(26)18(28)22-9-5-2-6-10-22/h1-14H2 |
| InChIKey | ZXOIWISEHIYBDD-UHFFFAOYSA-N |
| XLogP | -1.18 |
| TPSA | 115.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 420.47 |
| LogP ≤ 5 | -1.18 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|