C21H43N3 — CID 18719723
1,2,5,6-tetramethyl-4-(2,2,3,3,5,5,6,6-octamethylpiperidin-1-yl)-1,3-diazinane (PubChem CID 18719723) has the molecular formula C21H43N3 and a molecular weight of 337.60 g/mol. Its IUPAC name is 1,2,5,6-tetramethyl-4-(2,2,3,3,5,5,6,6-octamethylpiperidin-1-yl)-1,3-diazinane.
| Compound Name | 1,2,5,6-tetramethyl-4-(2,2,3,3,5,5,6,6-octamethylpiperidin-1-yl)-1,3-diazinane |
|---|---|
| PubChem CID | 18719723 |
| Molecular Formula | C21H43N3 |
| Molecular Weight | 337.60 g/mol |
| Exact Mass | 337.35 |
| IUPAC Name | 1,2,5,6-tetramethyl-4-(2,2,3,3,5,5,6,6-octamethylpiperidin-1-yl)-1,3-diazinane |
| SMILES | CC1C(C)N(C)C(C)NC1N1C(C)(C)C(C)(C)CC(C)(C)C1(C)C |
| InChI | InChI=1S/C21H43N3/c1-14-15(2)23(12)16(3)22-17(14)24-20(8,9)18(4,5)13-19(6,7)21(24,10)11/h14-17,22H,13H2,1-12H3 |
| InChIKey | SSKULDINXXZFJE-UHFFFAOYSA-N |
| XLogP | 4.53 |
| TPSA | 18.51 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 337.60 |
| LogP ≤ 5 | 4.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |