C12H20O — CID 18719775
(6E,8E)-7,8-dimethyldeca-6,8-dienal (PubChem CID 18719775) has the molecular formula C12H20O and a molecular weight of 180.29 g/mol. Its IUPAC name is (6E,8E)-7,8-dimethyldeca-6,8-dienal.
| Compound Name | (6E,8E)-7,8-dimethyldeca-6,8-dienal |
|---|---|
| PubChem CID | 18719775 |
| Molecular Formula | C12H20O |
| Molecular Weight | 180.29 g/mol |
| Exact Mass | 180.15 |
| IUPAC Name | (6E,8E)-7,8-dimethyldeca-6,8-dienal |
| SMILES | C/C=C(C)/C(C)=C/CCCCC=O |
| InChI | InChI=1S/C12H20O/c1-4-11(2)12(3)9-7-5-6-8-10-13/h4,9-10H,5-8H2,1-3H3/b11-4+,12-9+ |
| InChIKey | JLJXNTPJFSIKOL-RUVIVGLCSA-N |
| XLogP | 3.66 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 180.29 |
| LogP ≤ 5 | 3.66 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|