About 2,4-dimethylimidazolidine
2,4-dimethylimidazolidine (PubChem CID 18720030) has the molecular formula C5H12N2
and a molecular weight of 100.17 g/mol. Its IUPAC name is 2,4-dimethylimidazolidine.
Molecular Properties
| Compound Name | 2,4-dimethylimidazolidine |
| PubChem CID | 18720030 |
| Molecular Formula | C5H12N2 |
| Molecular Weight | 100.17 g/mol |
| Exact Mass | 100.10 |
| IUPAC Name | 2,4-dimethylimidazolidine |
| SMILES | CC1CNC(C)N1 |
| InChI | InChI=1S/C5H12N2/c1-4-3-6-5(2)7-4/h4-7H,3H2,1-2H3 |
| InChIKey | VXDFWZXQFKMRDR-UHFFFAOYSA-N |
| XLogP | -0.09 |
| TPSA | 24.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 7 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 100.17 |
| LogP ≤ 5 | -0.09 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 2,4-dimethylimidazolidine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2,4-dimethylimidazolidine?
The IUPAC name of 2,4-dimethylimidazolidine (CID 18720030) is 2,4-dimethylimidazolidine.
What is the SMILES notation for 2,4-dimethylimidazolidine?
The canonical SMILES for 2,4-dimethylimidazolidine is CC1CNC(C)N1.
What is the InChIKey of 2,4-dimethylimidazolidine?
The InChIKey is VXDFWZXQFKMRDR-UHFFFAOYSA-N. The full InChI is InChI=1S/C5H12N2/c1-4-3-6-5(2)7-4/h4-7H,3H2,1-2H3.
What are the key properties of 2,4-dimethylimidazolidine?
2,4-dimethylimidazolidine has a molecular weight of 100.17 g/mol, XLogP of -0.09, 0 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2,4-dimethylimidazolidine is sourced from PubChem (CID 18720030), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).