About 2,4-ditert-butyl-1,3-oxazolidine
2,4-ditert-butyl-1,3-oxazolidine (PubChem CID 18720035) has the molecular formula C11H23NO
and a molecular weight of 185.31 g/mol. Its IUPAC name is 2,4-ditert-butyl-1,3-oxazolidine.
Molecular Properties
| Compound Name | 2,4-ditert-butyl-1,3-oxazolidine |
| PubChem CID | 18720035 |
| Molecular Formula | C11H23NO |
| Molecular Weight | 185.31 g/mol |
| Exact Mass | 185.18 |
| IUPAC Name | 2,4-ditert-butyl-1,3-oxazolidine |
| SMILES | CC(C)(C)C1COC(C(C)(C)C)N1 |
| InChI | InChI=1S/C11H23NO/c1-10(2,3)8-7-13-9(12-8)11(4,5)6/h8-9,12H,7H2,1-6H3 |
| InChIKey | IMJOPSACTORHOD-UHFFFAOYSA-N |
| XLogP | 2.39 |
| TPSA | 21.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 185.31 |
| LogP ≤ 5 | 2.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 2,4-ditert-butyl-1,3-oxazolidine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2,4-ditert-butyl-1,3-oxazolidine?
The IUPAC name of 2,4-ditert-butyl-1,3-oxazolidine (CID 18720035) is 2,4-ditert-butyl-1,3-oxazolidine.
What is the SMILES notation for 2,4-ditert-butyl-1,3-oxazolidine?
The canonical SMILES for 2,4-ditert-butyl-1,3-oxazolidine is CC(C)(C)C1COC(C(C)(C)C)N1.
What is the InChIKey of 2,4-ditert-butyl-1,3-oxazolidine?
The InChIKey is IMJOPSACTORHOD-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H23NO/c1-10(2,3)8-7-13-9(12-8)11(4,5)6/h8-9,12H,7H2,1-6H3.
What are the key properties of 2,4-ditert-butyl-1,3-oxazolidine?
2,4-ditert-butyl-1,3-oxazolidine has a molecular weight of 185.31 g/mol, XLogP of 2.39, 0 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2,4-ditert-butyl-1,3-oxazolidine is sourced from PubChem (CID 18720035), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).