C13H22Cl2Si — CID 18720349
tert-butyl-dichloro-(2,3,4,5-tetramethylcyclopenta-2,4-dien-1-yl)silane (PubChem CID 18720349) has the molecular formula C13H22Cl2Si and a molecular weight of 277.31 g/mol. Its IUPAC name is tert-butyl-dichloro-(2,3,4,5-tetramethylcyclopenta-2,4-dien-1-yl)silane.
| Compound Name | tert-butyl-dichloro-(2,3,4,5-tetramethylcyclopenta-2,4-dien-1-yl)silane |
|---|---|
| PubChem CID | 18720349 |
| Molecular Formula | C13H22Cl2Si |
| Molecular Weight | 277.31 g/mol |
| Exact Mass | 276.09 |
| IUPAC Name | tert-butyl-dichloro-(2,3,4,5-tetramethylcyclopenta-2,4-dien-1-yl)silane |
| SMILES | CC1=C(C)C([Si](Cl)(Cl)C(C)(C)C)C(C)=C1C |
| InChI | InChI=1S/C13H22Cl2Si/c1-8-9(2)11(4)12(10(8)3)16(14,15)13(5,6)7/h12H,1-7H3 |
| InChIKey | DWFHYCVDAMIRBX-UHFFFAOYSA-N |
| XLogP | 5.76 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 277.31 |
| LogP ≤ 5 | 5.76 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'silicon_halogen', 'substructure': 'N/A'} |
|---|