About benzo[d][1,3]benzodioxepine
benzo[d][1,3]benzodioxepine (PubChem CID 18720397) has the molecular formula C13H10O2
and a molecular weight of 198.22 g/mol. Its IUPAC name is benzo[d][1,3]benzodioxepine.
Molecular Properties
| Compound Name | benzo[d][1,3]benzodioxepine |
| PubChem CID | 18720397 |
| Molecular Formula | C13H10O2 |
| Molecular Weight | 198.22 g/mol |
| Exact Mass | 198.07 |
| IUPAC Name | benzo[d][1,3]benzodioxepine |
| SMILES | c1ccc2c(c1)OCOc1ccccc1-2 |
| InChI | InChI=1S/C13H10O2/c1-3-7-12-10(5-1)11-6-2-4-8-13(11)15-9-14-12/h1-8H,9H2 |
| InChIKey | JXUHCIXSAQBFFS-UHFFFAOYSA-N |
| XLogP | 3.08 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 198.22 |
| LogP ≤ 5 | 3.08 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze benzo[d][1,3]benzodioxepine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of benzo[d][1,3]benzodioxepine?
The IUPAC name of benzo[d][1,3]benzodioxepine (CID 18720397) is benzo[d][1,3]benzodioxepine.
What is the SMILES notation for benzo[d][1,3]benzodioxepine?
The canonical SMILES for benzo[d][1,3]benzodioxepine is c1ccc2c(c1)OCOc1ccccc1-2.
What is the InChIKey of benzo[d][1,3]benzodioxepine?
The InChIKey is JXUHCIXSAQBFFS-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H10O2/c1-3-7-12-10(5-1)11-6-2-4-8-13(11)15-9-14-12/h1-8H,9H2.
What are the key properties of benzo[d][1,3]benzodioxepine?
benzo[d][1,3]benzodioxepine has a molecular weight of 198.22 g/mol, XLogP of 3.08, 0 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for benzo[d][1,3]benzodioxepine is sourced from PubChem (CID 18720397), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).