About 4-[(1-ethylpyridin-1-ium-3-yl)diazenyl]-N,N,3-trimethylaniline
4-[(1-ethylpyridin-1-ium-3-yl)diazenyl]-N,N,3-trimethylaniline (PubChem CID 18720653) has the molecular formula C16H21N4+
and a molecular weight of 269.37 g/mol. Its IUPAC name is 4-[(1-ethylpyridin-1-ium-3-yl)diazenyl]-N,N,3-trimethylaniline.
Molecular Properties
| Compound Name | 4-[(1-ethylpyridin-1-ium-3-yl)diazenyl]-N,N,3-trimethylaniline |
| PubChem CID | 18720653 |
| Molecular Formula | C16H21N4+ |
| Molecular Weight | 269.37 g/mol |
| Exact Mass | 269.18 |
| IUPAC Name | 4-[(1-ethylpyridin-1-ium-3-yl)diazenyl]-N,N,3-trimethylaniline |
| SMILES | CC[n+]1cccc(/N=N/c2ccc(N(C)C)cc2C)c1 |
| InChI | InChI=1S/C16H21N4/c1-5-20-10-6-7-14(12-20)17-18-16-9-8-15(19(3)4)11-13(16)2/h6-12H,5H2,1-4H3/q+1/b18-17+ |
| InChIKey | CPPHASUEIATYOF-ISLYRVAYSA-N |
| XLogP | 3.78 |
| TPSA | 31.84 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 269.37 |
| LogP ≤ 5 | 3.78 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|
Analyze 4-[(1-ethylpyridin-1-ium-3-yl)diazenyl]-N,N,3-trimethylaniline with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-[(1-ethylpyridin-1-ium-3-yl)diazenyl]-N,N,3-trimethylaniline?
The IUPAC name of 4-[(1-ethylpyridin-1-ium-3-yl)diazenyl]-N,N,3-trimethylaniline (CID 18720653) is 4-[(1-ethylpyridin-1-ium-3-yl)diazenyl]-N,N,3-trimethylaniline.
What is the SMILES notation for 4-[(1-ethylpyridin-1-ium-3-yl)diazenyl]-N,N,3-trimethylaniline?
The canonical SMILES for 4-[(1-ethylpyridin-1-ium-3-yl)diazenyl]-N,N,3-trimethylaniline is CC[n+]1cccc(/N=N/c2ccc(N(C)C)cc2C)c1.
What is the InChIKey of 4-[(1-ethylpyridin-1-ium-3-yl)diazenyl]-N,N,3-trimethylaniline?
The InChIKey is CPPHASUEIATYOF-ISLYRVAYSA-N. The full InChI is InChI=1S/C16H21N4/c1-5-20-10-6-7-14(12-20)17-18-16-9-8-15(19(3)4)11-13(16)2/h6-12H,5H2,1-4H3/q+1/b18-17+.
What are the key properties of 4-[(1-ethylpyridin-1-ium-3-yl)diazenyl]-N,N,3-trimethylaniline?
4-[(1-ethylpyridin-1-ium-3-yl)diazenyl]-N,N,3-trimethylaniline has a molecular weight of 269.37 g/mol, XLogP of 3.78, 4 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 4-[(1-ethylpyridin-1-ium-3-yl)diazenyl]-N,N,3-trimethylaniline is sourced from PubChem (CID 18720653), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).