About 5-methyl-2-phenyl-1,3-dioxane;bis(yttrium)
5-methyl-2-phenyl-1,3-dioxane;bis(yttrium) (PubChem CID 18720985) has the molecular formula C11H13O2Y2-
and a molecular weight of 355.04 g/mol. Its IUPAC name is 5-methyl-2-phenyl-1,3-dioxane;bis(yttrium).
Molecular Properties
| Compound Name | 5-methyl-2-phenyl-1,3-dioxane;bis(yttrium) |
| PubChem CID | 18720985 |
| Molecular Formula | C11H13O2Y2- |
| Molecular Weight | 355.04 g/mol |
| Exact Mass | 354.90 |
| IUPAC Name | 5-methyl-2-phenyl-1,3-dioxane;bis(yttrium) |
| SMILES | CC1COC(c2cc[c-]cc2)OC1.[Y].[Y] |
| InChI | InChI=1S/C11H13O2.2Y/c1-9-7-12-11(13-8-9)10-5-3-2-4-6-10;;/h3-6,9,11H,7-8H2,1H3;;/q-1;; |
| InChIKey | GGGJWVYUYWLTHM-UHFFFAOYSA-N |
| XLogP | 2.16 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 355.04 |
| LogP ≤ 5 | 2.16 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|
Analyze 5-methyl-2-phenyl-1,3-dioxane;bis(yttrium) with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-methyl-2-phenyl-1,3-dioxane;bis(yttrium)?
The IUPAC name of 5-methyl-2-phenyl-1,3-dioxane;bis(yttrium) (CID 18720985) is 5-methyl-2-phenyl-1,3-dioxane;bis(yttrium).
What is the SMILES notation for 5-methyl-2-phenyl-1,3-dioxane;bis(yttrium)?
The canonical SMILES for 5-methyl-2-phenyl-1,3-dioxane;bis(yttrium) is CC1COC(c2cc[c-]cc2)OC1.[Y].[Y].
What is the InChIKey of 5-methyl-2-phenyl-1,3-dioxane;bis(yttrium)?
The InChIKey is GGGJWVYUYWLTHM-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H13O2.2Y/c1-9-7-12-11(13-8-9)10-5-3-2-4-6-10;;/h3-6,9,11H,7-8H2,1H3;;/q-1;;.
What are the key properties of 5-methyl-2-phenyl-1,3-dioxane;bis(yttrium)?
5-methyl-2-phenyl-1,3-dioxane;bis(yttrium) has a molecular weight of 355.04 g/mol, XLogP of 2.16, 1 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 5-methyl-2-phenyl-1,3-dioxane;bis(yttrium) is sourced from PubChem (CID 18720985), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).