About 5-O-ethyl 1-O-methyl 4-ethyl-2,2-dimethylpentanedioate
5-O-ethyl 1-O-methyl 4-ethyl-2,2-dimethylpentanedioate (PubChem CID 18721111) has the molecular formula C12H22O4
and a molecular weight of 230.30 g/mol. Its IUPAC name is 5-O-ethyl 1-O-methyl 4-ethyl-2,2-dimethylpentanedioate.
Molecular Properties
| Compound Name | 5-O-ethyl 1-O-methyl 4-ethyl-2,2-dimethylpentanedioate |
| PubChem CID | 18721111 |
| Molecular Formula | C12H22O4 |
| Molecular Weight | 230.30 g/mol |
| Exact Mass | 230.15 |
| IUPAC Name | 5-O-ethyl 1-O-methyl 4-ethyl-2,2-dimethylpentanedioate |
| SMILES | CCOC(=O)C(CC)CC(C)(C)C(=O)OC |
| InChI | InChI=1S/C12H22O4/c1-6-9(10(13)16-7-2)8-12(3,4)11(14)15-5/h9H,6-8H2,1-5H3 |
| InChIKey | XFVODRIJDCKJRT-UHFFFAOYSA-N |
| XLogP | 2.16 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 230.30 |
| LogP ≤ 5 | 2.16 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 5-O-ethyl 1-O-methyl 4-ethyl-2,2-dimethylpentanedioate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-O-ethyl 1-O-methyl 4-ethyl-2,2-dimethylpentanedioate?
The IUPAC name of 5-O-ethyl 1-O-methyl 4-ethyl-2,2-dimethylpentanedioate (CID 18721111) is 5-O-ethyl 1-O-methyl 4-ethyl-2,2-dimethylpentanedioate.
What is the SMILES notation for 5-O-ethyl 1-O-methyl 4-ethyl-2,2-dimethylpentanedioate?
The canonical SMILES for 5-O-ethyl 1-O-methyl 4-ethyl-2,2-dimethylpentanedioate is CCOC(=O)C(CC)CC(C)(C)C(=O)OC.
What is the InChIKey of 5-O-ethyl 1-O-methyl 4-ethyl-2,2-dimethylpentanedioate?
The InChIKey is XFVODRIJDCKJRT-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H22O4/c1-6-9(10(13)16-7-2)8-12(3,4)11(14)15-5/h9H,6-8H2,1-5H3.
What are the key properties of 5-O-ethyl 1-O-methyl 4-ethyl-2,2-dimethylpentanedioate?
5-O-ethyl 1-O-methyl 4-ethyl-2,2-dimethylpentanedioate has a molecular weight of 230.30 g/mol, XLogP of 2.16, 6 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 5-O-ethyl 1-O-methyl 4-ethyl-2,2-dimethylpentanedioate is sourced from PubChem (CID 18721111), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).