C15H28O2 — CID 18721136
5-methyl-2-[3-(4-methylcyclohexyl)propyl]-1,3-dioxane (PubChem CID 18721136) has the molecular formula C15H28O2 and a molecular weight of 240.39 g/mol. Its IUPAC name is 5-methyl-2-[3-(4-methylcyclohexyl)propyl]-1,3-dioxane.
| Compound Name | 5-methyl-2-[3-(4-methylcyclohexyl)propyl]-1,3-dioxane |
|---|---|
| PubChem CID | 18721136 |
| Molecular Formula | C15H28O2 |
| Molecular Weight | 240.39 g/mol |
| Exact Mass | 240.21 |
| IUPAC Name | 5-methyl-2-[3-(4-methylcyclohexyl)propyl]-1,3-dioxane |
| SMILES | CC1CCC(CCCC2OCC(C)CO2)CC1 |
| InChI | InChI=1S/C15H28O2/c1-12-6-8-14(9-7-12)4-3-5-15-16-10-13(2)11-17-15/h12-15H,3-11H2,1-2H3 |
| InChIKey | JYHPVRYPPQPAFH-UHFFFAOYSA-N |
| XLogP | 3.99 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 240.39 |
| LogP ≤ 5 | 3.99 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |